C26H21NO2 — CID 69133649
2-cyano-2-[naphthalen-1-yl(naphthalen-2-yl)methyl]butanoic acid (PubChem CID 69133649) has the molecular formula C26H21NO2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-cyano-2-[naphthalen-1-yl(naphthalen-2-yl)methyl]butanoic acid.
| Compound Name | 2-cyano-2-[naphthalen-1-yl(naphthalen-2-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 69133649 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-cyano-2-[naphthalen-1-yl(naphthalen-2-yl)methyl]butanoic acid |
| SMILES | CCC(C#N)(C(=O)O)C(c1ccc2ccccc2c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H21NO2/c1-2-26(17-27,25(28)29)24(21-15-14-18-8-3-4-10-20(18)16-21)23-13-7-11-19-9-5-6-12-22(19)23/h3-16,24H,2H2,1H3,(H,28,29) |
| InChIKey | UUEORYJQZFORJB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |