C22H20N2O4 — CID 69132928
2-cyano-2-(methoxymethyl)-3-(2-methoxyphenyl)-3-quinolin-3-ylpropanoic acid (PubChem CID 69132928) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-cyano-2-(methoxymethyl)-3-(2-methoxyphenyl)-3-quinolin-3-ylpropanoic acid.
| Compound Name | 2-cyano-2-(methoxymethyl)-3-(2-methoxyphenyl)-3-quinolin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 69132928 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-cyano-2-(methoxymethyl)-3-(2-methoxyphenyl)-3-quinolin-3-ylpropanoic acid |
| SMILES | COCC(C#N)(C(=O)O)C(c1cnc2ccccc2c1)c1ccccc1OC |
| InChI | InChI=1S/C22H20N2O4/c1-27-14-22(13-23,21(25)26)20(17-8-4-6-10-19(17)28-2)16-11-15-7-3-5-9-18(15)24-12-16/h3-12,20H,14H2,1-2H3,(H,25,26) |
| InChIKey | JFAWEVIKSNNIKQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |