C29H34N2O5S — CID 69135283
(2S)-2-[[4-[4-[(E)-2-(6-methoxynaphthalen-2-yl)ethenyl]phenyl]piperidin-1-yl]sulfonylamino]pentanoic acid (PubChem CID 69135283) has the molecular formula C29H34N2O5S and a molecular weight of 522.67 g/mol. Its IUPAC name is (2S)-2-[[4-[4-[(E)-2-(6-methoxynaphthalen-2-yl)ethenyl]phenyl]piperidin-1-yl]sulfonylamino]pentanoic acid.
| Compound Name | (2S)-2-[[4-[4-[(E)-2-(6-methoxynaphthalen-2-yl)ethenyl]phenyl]piperidin-1-yl]sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 69135283 |
| Molecular Formula | C29H34N2O5S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | (2S)-2-[[4-[4-[(E)-2-(6-methoxynaphthalen-2-yl)ethenyl]phenyl]piperidin-1-yl]sulfonylamino]pentanoic acid |
| SMILES | CCC[C@H](NS(=O)(=O)N1CCC(c2ccc(/C=C/c3ccc4cc(OC)ccc4c3)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C29H34N2O5S/c1-3-4-28(29(32)33)30-37(34,35)31-17-15-24(16-18-31)23-10-7-21(8-11-23)5-6-22-9-12-26-20-27(36-2)14-13-25(26)19-22/h5-14,19-20,24,28,30H,3-4,15-18H2,1-2H3,(H,32,33)/b6-5+/t28-/m0/s1 |
| InChIKey | JYUKKADZHFOTOK-GFPUREGVSA-N |
| XLogP | 5.29 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|