C14H11N5O2S — CID 69138095
3-(2-phenylsulfanyl-1H-pyrrol-3-yl)-1-(2H-tetrazol-5-yl)propane-1,2-dione (PubChem CID 69138095) has the molecular formula C14H11N5O2S and a molecular weight of 313.34 g/mol. Its IUPAC name is 3-(2-phenylsulfanyl-1H-pyrrol-3-yl)-1-(2H-tetrazol-5-yl)propane-1,2-dione.
| Compound Name | 3-(2-phenylsulfanyl-1H-pyrrol-3-yl)-1-(2H-tetrazol-5-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 69138095 |
| Molecular Formula | C14H11N5O2S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-(2-phenylsulfanyl-1H-pyrrol-3-yl)-1-(2H-tetrazol-5-yl)propane-1,2-dione |
| SMILES | O=C(Cc1cc[nH]c1Sc1ccccc1)C(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C14H11N5O2S/c20-11(12(21)13-16-18-19-17-13)8-9-6-7-15-14(9)22-10-4-2-1-3-5-10/h1-7,15H,8H2,(H,16,17,18,19) |
| InChIKey | IPMROJPTJAGBSX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|