C15H12N4O2S — CID 69138103
3-(4-benzylthiophen-3-yl)-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one (PubChem CID 69138103) has the molecular formula C15H12N4O2S and a molecular weight of 312.35 g/mol. Its IUPAC name is 3-(4-benzylthiophen-3-yl)-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one.
| Compound Name | 3-(4-benzylthiophen-3-yl)-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69138103 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-(4-benzylthiophen-3-yl)-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1cscc1Cc1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H12N4O2S/c20-13(7-14(21)15-16-18-19-17-15)12-9-22-8-11(12)6-10-4-2-1-3-5-10/h1-5,7-9,20H,6H2,(H,16,17,18,19) |
| InChIKey | FRRLTBMYVFSBHI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|