C13H11N7O2 — CID 69140846
3-hydroxy-3-[4-(pyridin-2-ylmethyl)-1H-pyrazol-5-yl]-1-(2H-tetrazol-5-yl)prop-2-en-1-one (PubChem CID 69140846) has the molecular formula C13H11N7O2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 3-hydroxy-3-[4-(pyridin-2-ylmethyl)-1H-pyrazol-5-yl]-1-(2H-tetrazol-5-yl)prop-2-en-1-one.
| Compound Name | 3-hydroxy-3-[4-(pyridin-2-ylmethyl)-1H-pyrazol-5-yl]-1-(2H-tetrazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69140846 |
| Molecular Formula | C13H11N7O2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-hydroxy-3-[4-(pyridin-2-ylmethyl)-1H-pyrazol-5-yl]-1-(2H-tetrazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1[nH]ncc1Cc1ccccn1)c1nn[nH]n1 |
| InChI | InChI=1S/C13H11N7O2/c21-10(6-11(22)13-17-19-20-18-13)12-8(7-15-16-12)5-9-3-1-2-4-14-9/h1-4,6-7,21H,5H2,(H,15,16)(H,17,18,19,20) |
| InChIKey | FJCPKBIBOJUIIO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|