C15H11FN4O2S — CID 69138574
3-[2-[(2-fluorophenyl)methyl]-1,3-thiazol-4-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (PubChem CID 69138574) has the molecular formula C15H11FN4O2S and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-[2-[(2-fluorophenyl)methyl]-1,3-thiazol-4-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one.
| Compound Name | 3-[2-[(2-fluorophenyl)methyl]-1,3-thiazol-4-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69138574 |
| Molecular Formula | C15H11FN4O2S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-[2-[(2-fluorophenyl)methyl]-1,3-thiazol-4-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1csc(Cc2ccccc2F)n1)c1ncn[nH]1 |
| InChI | InChI=1S/C15H11FN4O2S/c16-10-4-2-1-3-9(10)5-14-19-11(7-23-14)12(21)6-13(22)15-17-8-18-20-15/h1-4,6-8,21H,5H2,(H,17,18,20) |
| InChIKey | ADAZNQDBZUOOKS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|