C15H11FN4O3 — CID 69138780
3-[2-[(3-fluorophenyl)methyl]furan-3-yl]-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one (PubChem CID 69138780) has the molecular formula C15H11FN4O3 and a molecular weight of 314.28 g/mol. Its IUPAC name is 3-[2-[(3-fluorophenyl)methyl]furan-3-yl]-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one.
| Compound Name | 3-[2-[(3-fluorophenyl)methyl]furan-3-yl]-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69138780 |
| Molecular Formula | C15H11FN4O3 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-[2-[(3-fluorophenyl)methyl]furan-3-yl]-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1ccoc1Cc1cccc(F)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H11FN4O3/c16-10-3-1-2-9(6-10)7-14-11(4-5-23-14)12(21)8-13(22)15-17-19-20-18-15/h1-6,8,21H,7H2,(H,17,18,19,20) |
| InChIKey | XVOHVAYRFOEQQF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|