C22H16FN5O3 — CID 69138465
3-[5-benzoyl-1-[(3-fluorophenyl)methyl]pyrrol-3-yl]-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one (PubChem CID 69138465) has the molecular formula C22H16FN5O3 and a molecular weight of 417.40 g/mol. Its IUPAC name is 3-[5-benzoyl-1-[(3-fluorophenyl)methyl]pyrrol-3-yl]-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one.
| Compound Name | 3-[5-benzoyl-1-[(3-fluorophenyl)methyl]pyrrol-3-yl]-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69138465 |
| Molecular Formula | C22H16FN5O3 |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-[5-benzoyl-1-[(3-fluorophenyl)methyl]pyrrol-3-yl]-3-hydroxy-1-(2H-tetrazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1cc(C(=O)c2ccccc2)n(Cc2cccc(F)c2)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C22H16FN5O3/c23-17-8-4-5-14(9-17)12-28-13-16(19(29)11-20(30)22-24-26-27-25-22)10-18(28)21(31)15-6-2-1-3-7-15/h1-11,13,29H,12H2,(H,24,25,26,27) |
| InChIKey | NVORVSAHVFAJJE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|