C12H9ClFNO2 — CID 114603713
4-chloro-1-[(3-fluorophenyl)methyl]pyrrole-2-carboxylic acid (PubChem CID 114603713) has the molecular formula C12H9ClFNO2 and a molecular weight of 253.66 g/mol. Its IUPAC name is 4-chloro-1-[(3-fluorophenyl)methyl]pyrrole-2-carboxylic acid.
| Compound Name | 4-chloro-1-[(3-fluorophenyl)methyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114603713 |
| Molecular Formula | C12H9ClFNO2 |
| Molecular Weight | 253.66 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-chloro-1-[(3-fluorophenyl)methyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)cn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H9ClFNO2/c13-9-5-11(12(16)17)15(7-9)6-8-2-1-3-10(14)4-8/h1-5,7H,6H2,(H,16,17) |
| InChIKey | YOLBTBWXBDSWIS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.66 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |