C13H9F4NO2 — CID 84756268
1-[(3-fluorophenyl)methyl]-2-(trifluoromethyl)pyrrole-3-carboxylic acid (PubChem CID 84756268) has the molecular formula C13H9F4NO2 and a molecular weight of 287.21 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-2-(trifluoromethyl)pyrrole-3-carboxylic acid.
| Compound Name | 1-[(3-fluorophenyl)methyl]-2-(trifluoromethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 84756268 |
| Molecular Formula | C13H9F4NO2 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-2-(trifluoromethyl)pyrrole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(Cc2cccc(F)c2)c1C(F)(F)F |
| InChI | InChI=1S/C13H9F4NO2/c14-9-3-1-2-8(6-9)7-18-5-4-10(12(19)20)11(18)13(15,16)17/h1-6H,7H2,(H,19,20) |
| InChIKey | LFOQAYZBYRGCEM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |