C17H14FN5O6S — CID 69140376
ethyl 1-(4-fluorophenyl)sulfonyl-5-[3-hydroxy-3-(2H-tetrazol-5-yl)prop-2-enoyl]pyrrole-3-carboxylate (PubChem CID 69140376) has the molecular formula C17H14FN5O6S and a molecular weight of 435.39 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)sulfonyl-5-[3-hydroxy-3-(2H-tetrazol-5-yl)prop-2-enoyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 1-(4-fluorophenyl)sulfonyl-5-[3-hydroxy-3-(2H-tetrazol-5-yl)prop-2-enoyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 69140376 |
| Molecular Formula | C17H14FN5O6S |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)sulfonyl-5-[3-hydroxy-3-(2H-tetrazol-5-yl)prop-2-enoyl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)C=C(O)c2nn[nH]n2)n(S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H14FN5O6S/c1-2-29-17(26)10-7-13(14(24)8-15(25)16-19-21-22-20-16)23(9-10)30(27,28)12-5-3-11(18)4-6-12/h3-9,25H,2H2,1H3,(H,19,20,21,22) |
| InChIKey | HZDKXAVCRIQYQT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|