ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen

C4H8N4O2 — CID 155716466

IUPACethyl 2H-tetrazole-5-carboxylate;molecular hydrogen
SMILESCCOC(=O)c1nn[nH]n1.[H][H]
InChIInChI=1S/C4H6N4O2.H2/c1-2-10-4(9)3-5-7-8-6-3;/h2H2,1H3,(H,5,6,7,8);1H
InChIKeyXEXAOZFBYISJIP-UHFFFAOYSA-N
MW144.13 g/mol
LogP-0.38
Rot. Bonds2

About ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen

ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen (PubChem CID 155716466) has the molecular formula C4H8N4O2 and a molecular weight of 144.13 g/mol. Its IUPAC name is ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen.

Molecular Properties

Compound Nameethyl 2H-tetrazole-5-carboxylate;molecular hydrogen
PubChem CID155716466
Molecular FormulaC4H8N4O2
Molecular Weight144.13 g/mol
Exact Mass144.06
IUPAC Nameethyl 2H-tetrazole-5-carboxylate;molecular hydrogen
SMILESCCOC(=O)c1nn[nH]n1.[H][H]
InChIInChI=1S/C4H6N4O2.H2/c1-2-10-4(9)3-5-7-8-6-3;/h2H2,1H3,(H,5,6,7,8);1H
InChIKeyXEXAOZFBYISJIP-UHFFFAOYSA-N
XLogP-0.38
TPSA80.76 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.13
LogP ≤ 5-0.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen?
The IUPAC name of ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen (CID 155716466) is ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen.
What is the SMILES notation for ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen?
The canonical SMILES for ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen is CCOC(=O)c1nn[nH]n1.[H][H].
What is the InChIKey of ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen?
The InChIKey is XEXAOZFBYISJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O2.H2/c1-2-10-4(9)3-5-7-8-6-3;/h2H2,1H3,(H,5,6,7,8);1H.
What are the key properties of ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen?
ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen has a molecular weight of 144.13 g/mol, XLogP of -0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2H-tetrazole-5-carboxylate;molecular hydrogen is sourced from PubChem (CID 155716466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).