C10H9FN4O2 — CID 84758809
2-[1-[(3-fluorophenyl)methyl]tetrazol-5-yl]acetic acid (PubChem CID 84758809) has the molecular formula C10H9FN4O2 and a molecular weight of 236.21 g/mol. Its IUPAC name is 2-[1-[(3-fluorophenyl)methyl]tetrazol-5-yl]acetic acid.
| Compound Name | 2-[1-[(3-fluorophenyl)methyl]tetrazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 84758809 |
| Molecular Formula | C10H9FN4O2 |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-[1-[(3-fluorophenyl)methyl]tetrazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1nnnn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C10H9FN4O2/c11-8-3-1-2-7(4-8)6-15-9(5-10(16)17)12-13-14-15/h1-4H,5-6H2,(H,16,17) |
| InChIKey | ZQWHERLJKVFOCS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |