C13H14FN5O3 — CID 117097838
2-[[2-[1-[(3-fluorophenyl)methyl]tetrazol-5-yl]acetyl]amino]propanoic acid (PubChem CID 117097838) has the molecular formula C13H14FN5O3 and a molecular weight of 307.29 g/mol. Its IUPAC name is 2-[[2-[1-[(3-fluorophenyl)methyl]tetrazol-5-yl]acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-[1-[(3-fluorophenyl)methyl]tetrazol-5-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 117097838 |
| Molecular Formula | C13H14FN5O3 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[[2-[1-[(3-fluorophenyl)methyl]tetrazol-5-yl]acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)Cc1nnnn1Cc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C13H14FN5O3/c1-8(13(21)22)15-12(20)6-11-16-17-18-19(11)7-9-3-2-4-10(14)5-9/h2-5,8H,6-7H2,1H3,(H,15,20)(H,21,22) |
| InChIKey | IICOYEXWDPCUMF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |