C11H17N5O5 — CID 117097826
2-[[2-[1-(3-ethoxy-3-oxopropyl)tetrazol-5-yl]acetyl]amino]propanoic acid (PubChem CID 117097826) has the molecular formula C11H17N5O5 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-[[2-[1-(3-ethoxy-3-oxopropyl)tetrazol-5-yl]acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-[1-(3-ethoxy-3-oxopropyl)tetrazol-5-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 117097826 |
| Molecular Formula | C11H17N5O5 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[[2-[1-(3-ethoxy-3-oxopropyl)tetrazol-5-yl]acetyl]amino]propanoic acid |
| SMILES | CCOC(=O)CCn1nnnc1CC(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C11H17N5O5/c1-3-21-10(18)4-5-16-8(13-14-15-16)6-9(17)12-7(2)11(19)20/h7H,3-6H2,1-2H3,(H,12,17)(H,19,20) |
| InChIKey | JFKIBYCFRTZCBP-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |