C9H14N6O4 — CID 117097846
2-[[2-[1-(3-amino-3-oxopropyl)tetrazol-5-yl]acetyl]amino]propanoic acid (PubChem CID 117097846) has the molecular formula C9H14N6O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-[[2-[1-(3-amino-3-oxopropyl)tetrazol-5-yl]acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-[1-(3-amino-3-oxopropyl)tetrazol-5-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 117097846 |
| Molecular Formula | C9H14N6O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[[2-[1-(3-amino-3-oxopropyl)tetrazol-5-yl]acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)Cc1nnnn1CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H14N6O4/c1-5(9(18)19)11-8(17)4-7-12-13-14-15(7)3-2-6(10)16/h5H,2-4H2,1H3,(H2,10,16)(H,11,17)(H,18,19) |
| InChIKey | UBNDTCFVSGDRSG-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |