C13H14N4O4 — CID 84758853
3-[1-[(3-methoxycarbonylphenyl)methyl]tetrazol-5-yl]propanoic acid (PubChem CID 84758853) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-[1-[(3-methoxycarbonylphenyl)methyl]tetrazol-5-yl]propanoic acid.
| Compound Name | 3-[1-[(3-methoxycarbonylphenyl)methyl]tetrazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 84758853 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-[1-[(3-methoxycarbonylphenyl)methyl]tetrazol-5-yl]propanoic acid |
| SMILES | COC(=O)c1cccc(Cn2nnnc2CCC(=O)O)c1 |
| InChI | InChI=1S/C13H14N4O4/c1-21-13(20)10-4-2-3-9(7-10)8-17-11(14-15-16-17)5-6-12(18)19/h2-4,7H,5-6,8H2,1H3,(H,18,19) |
| InChIKey | APDHEALAYLGRRO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |