C17H22N2O — CID 69139218
3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile (PubChem CID 69139218) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile.
| Compound Name | 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile |
|---|---|
| PubChem CID | 69139218 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile |
| SMILES | N#Cc1cccc([C@@]23CCC(NCCCO)C[C@@H]2C3)c1 |
| InChI | InChI=1S/C17H22N2O/c18-12-13-3-1-4-14(9-13)17-6-5-16(10-15(17)11-17)19-7-2-8-20/h1,3-4,9,15-16,19-20H,2,5-8,10-11H2/t15-,16?,17+/m1/s1 |
| InChIKey | RGGWWLDUPGMMKM-SKQWJGTPSA-N |
| XLogP | 2.34 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|