About 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile
3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile (PubChem CID 69139218) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile |
| PubChem CID | 69139218 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile |
| SMILES | N#Cc1cccc([C@@]23CCC(NCCCO)C[C@@H]2C3)c1 |
| InChI | InChI=1S/C17H22N2O/c18-12-13-3-1-4-14(9-13)17-6-5-16(10-15(17)11-17)19-7-2-8-20/h1,3-4,9,15-16,19-20H,2,5-8,10-11H2/t15-,16?,17+/m1/s1 |
| InChIKey | RGGWWLDUPGMMKM-SKQWJGTPSA-N |
| XLogP | 2.34 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile?
The IUPAC name of 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile (CID 69139218) is 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile.
What is the SMILES notation for 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile?
The canonical SMILES for 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile is N#Cc1cccc([C@@]23CCC(NCCCO)C[C@@H]2C3)c1.
What is the InChIKey of 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile?
The InChIKey is RGGWWLDUPGMMKM-SKQWJGTPSA-N. The full InChI is InChI=1S/C17H22N2O/c18-12-13-3-1-4-14(9-13)17-6-5-16(10-15(17)11-17)19-7-2-8-20/h1,3-4,9,15-16,19-20H,2,5-8,10-11H2/t15-,16?,17+/m1/s1.
What are the key properties of 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile?
3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile has a molecular weight of 270.38 g/mol, XLogP of 2.34, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,6S)-4-(3-hydroxypropylamino)-1-bicyclo[4.1.0]heptanyl]benzonitrile is sourced from PubChem (CID 69139218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).