About (Z)-3,4-bis(sulfanyl)but-3-en-2-one
(Z)-3,4-bis(sulfanyl)but-3-en-2-one (PubChem CID 6914072) has the molecular formula C4H6OS2
and a molecular weight of 134.22 g/mol. Its IUPAC name is (Z)-3,4-bis(sulfanyl)but-3-en-2-one.
Molecular Properties
| Compound Name | (Z)-3,4-bis(sulfanyl)but-3-en-2-one |
| PubChem CID | 6914072 |
| Molecular Formula | C4H6OS2 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 133.99 |
| IUPAC Name | (Z)-3,4-bis(sulfanyl)but-3-en-2-one |
| SMILES | CC(=O)/C(S)=C/S |
| InChI | InChI=1S/C4H6OS2/c1-3(5)4(7)2-6/h2,6-7H,1H3/b4-2- |
| InChIKey | YKWRZICAYLCXJW-RQOWECAXSA-N |
| XLogP | 1.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,4-bis(sulfanyl)but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4-bis(sulfanyl)but-3-en-2-one?
The IUPAC name of (Z)-3,4-bis(sulfanyl)but-3-en-2-one (CID 6914072) is (Z)-3,4-bis(sulfanyl)but-3-en-2-one.
What is the SMILES notation for (Z)-3,4-bis(sulfanyl)but-3-en-2-one?
The canonical SMILES for (Z)-3,4-bis(sulfanyl)but-3-en-2-one is CC(=O)/C(S)=C/S.
What is the InChIKey of (Z)-3,4-bis(sulfanyl)but-3-en-2-one?
The InChIKey is YKWRZICAYLCXJW-RQOWECAXSA-N. The full InChI is InChI=1S/C4H6OS2/c1-3(5)4(7)2-6/h2,6-7H,1H3/b4-2-.
What are the key properties of (Z)-3,4-bis(sulfanyl)but-3-en-2-one?
(Z)-3,4-bis(sulfanyl)but-3-en-2-one has a molecular weight of 134.22 g/mol, XLogP of 1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4-bis(sulfanyl)but-3-en-2-one is sourced from PubChem (CID 6914072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).