C14H9FO6S2 — CID 69140875
4-[3-(4-fluorophenyl)sulfonylthiophen-2-yl]-2-hydroxy-4-oxobut-2-enoic acid (PubChem CID 69140875) has the molecular formula C14H9FO6S2 and a molecular weight of 356.35 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)sulfonylthiophen-2-yl]-2-hydroxy-4-oxobut-2-enoic acid.
| Compound Name | 4-[3-(4-fluorophenyl)sulfonylthiophen-2-yl]-2-hydroxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 69140875 |
| Molecular Formula | C14H9FO6S2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 4-[3-(4-fluorophenyl)sulfonylthiophen-2-yl]-2-hydroxy-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C(O)=CC(=O)c1sccc1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H9FO6S2/c15-8-1-3-9(4-2-8)23(20,21)12-5-6-22-13(12)10(16)7-11(17)14(18)19/h1-7,17H,(H,18,19) |
| InChIKey | XMMNCVHSEXXGSK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|