(4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate

C14H19ClN2O2 — CID 69141542

IUPAC(4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate
SMILESCC1CNCC(C)N1C(=O)OCc1ccc(Cl)cc1
InChIInChI=1S/C14H19ClN2O2/c1-10-7-16-8-11(2)17(10)14(18)19-9-12-3-5-13(15)6-4-12/h3-6,10-11,16H,7-9H2,1-2H3
InChIKeyXSCKPOBGYVJTAW-UHFFFAOYSA-N
MW282.77 g/mol
LogP2.66
Rot. Bonds2

About (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate

(4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate (PubChem CID 69141542) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate.

Molecular Properties

Compound Name(4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate
PubChem CID69141542
Molecular FormulaC14H19ClN2O2
Molecular Weight282.77 g/mol
Exact Mass282.11
IUPAC Name(4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate
SMILESCC1CNCC(C)N1C(=O)OCc1ccc(Cl)cc1
InChIInChI=1S/C14H19ClN2O2/c1-10-7-16-8-11(2)17(10)14(18)19-9-12-3-5-13(15)6-4-12/h3-6,10-11,16H,7-9H2,1-2H3
InChIKeyXSCKPOBGYVJTAW-UHFFFAOYSA-N
XLogP2.66
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.77
LogP ≤ 52.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate?
The IUPAC name of (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate (CID 69141542) is (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate.
What is the SMILES notation for (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate?
The canonical SMILES for (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate is CC1CNCC(C)N1C(=O)OCc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate?
The InChIKey is XSCKPOBGYVJTAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN2O2/c1-10-7-16-8-11(2)17(10)14(18)19-9-12-3-5-13(15)6-4-12/h3-6,10-11,16H,7-9H2,1-2H3.
What are the key properties of (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate?
(4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate has a molecular weight of 282.77 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 2,6-dimethylpiperazine-1-carboxylate is sourced from PubChem (CID 69141542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).