C23H29FN2O3 — CID 21021892
[2-fluoro-5-(3-phenylpropoxy)phenyl]methyl (2R,6S)-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 21021892) has the molecular formula C23H29FN2O3 and a molecular weight of 400.49 g/mol. Its IUPAC name is [2-fluoro-5-(3-phenylpropoxy)phenyl]methyl (2R,6S)-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | [2-fluoro-5-(3-phenylpropoxy)phenyl]methyl (2R,6S)-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 21021892 |
| Molecular Formula | C23H29FN2O3 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [2-fluoro-5-(3-phenylpropoxy)phenyl]methyl (2R,6S)-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CNC[C@H](C)N1C(=O)OCc1cc(OCCCc2ccccc2)ccc1F |
| InChI | InChI=1S/C23H29FN2O3/c1-17-14-25-15-18(2)26(17)23(27)29-16-20-13-21(10-11-22(20)24)28-12-6-9-19-7-4-3-5-8-19/h3-5,7-8,10-11,13,17-18,25H,6,9,12,14-16H2,1-2H3/t17-,18+ |
| InChIKey | WMGDMODVSHLKBC-HDICACEKSA-N |
| XLogP | 4.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|