C20H26FN3O3 — CID 69141655
[2-fluoro-5-(2-pyrrol-1-ylethoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate (PubChem CID 69141655) has the molecular formula C20H26FN3O3 and a molecular weight of 375.44 g/mol. Its IUPAC name is [2-fluoro-5-(2-pyrrol-1-ylethoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate.
| Compound Name | [2-fluoro-5-(2-pyrrol-1-ylethoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 69141655 |
| Molecular Formula | C20H26FN3O3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | [2-fluoro-5-(2-pyrrol-1-ylethoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate |
| SMILES | CC[C@@H]1CNCCN1C(=O)OCc1cc(OCCn2cccc2)ccc1F |
| InChI | InChI=1S/C20H26FN3O3/c1-2-17-14-22-7-10-24(17)20(25)27-15-16-13-18(5-6-19(16)21)26-12-11-23-8-3-4-9-23/h3-6,8-9,13,17,22H,2,7,10-12,14-15H2,1H3/t17-/m1/s1 |
| InChIKey | CTPUVJIXOAITFK-QGZVFWFLSA-N |
| XLogP | 3.03 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |