C18H27FN2O3 — CID 69141844
(5-butoxy-2-fluorophenyl)methyl (2R)-2-ethylpiperazine-1-carboxylate (PubChem CID 69141844) has the molecular formula C18H27FN2O3 and a molecular weight of 338.42 g/mol. Its IUPAC name is (5-butoxy-2-fluorophenyl)methyl (2R)-2-ethylpiperazine-1-carboxylate.
| Compound Name | (5-butoxy-2-fluorophenyl)methyl (2R)-2-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 69141844 |
| Molecular Formula | C18H27FN2O3 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (5-butoxy-2-fluorophenyl)methyl (2R)-2-ethylpiperazine-1-carboxylate |
| SMILES | CCCCOc1ccc(F)c(COC(=O)N2CCNC[C@H]2CC)c1 |
| InChI | InChI=1S/C18H27FN2O3/c1-3-5-10-23-16-6-7-17(19)14(11-16)13-24-18(22)21-9-8-20-12-15(21)4-2/h6-7,11,15,20H,3-5,8-10,12-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | FODKKVSSXVWKOY-OAHLLOKOSA-N |
| XLogP | 3.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|