About [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride
[2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride (PubChem CID 69143959) has the molecular formula C17H25ClF2N2O4
and a molecular weight of 394.85 g/mol. Its IUPAC name is [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride |
| PubChem CID | 69143959 |
| Molecular Formula | C17H25ClF2N2O4 |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride |
| SMILES | CCC1CNCCN1C(=O)OCc1c(F)ccc(OCCOC)c1F.Cl |
| InChI | InChI=1S/C17H24F2N2O4.ClH/c1-3-12-10-20-6-7-21(12)17(22)25-11-13-14(18)4-5-15(16(13)19)24-9-8-23-2;/h4-5,12,20H,3,6-11H2,1-2H3;1H |
| InChIKey | OUXDOAYFKIQRJJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride?
The IUPAC name of [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride (CID 69143959) is [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride.
What is the SMILES notation for [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride?
The canonical SMILES for [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride is CCC1CNCCN1C(=O)OCc1c(F)ccc(OCCOC)c1F.Cl.
What is the InChIKey of [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride?
The InChIKey is OUXDOAYFKIQRJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F2N2O4.ClH/c1-3-12-10-20-6-7-21(12)17(22)25-11-13-14(18)4-5-15(16(13)19)24-9-8-23-2;/h4-5,12,20H,3,6-11H2,1-2H3;1H.
What are the key properties of [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride?
[2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride has a molecular weight of 394.85 g/mol, XLogP of 2.73, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl 2-ethylpiperazine-1-carboxylate;hydrochloride is sourced from PubChem (CID 69143959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).