C23H29FN2O4 — CID 69142341
[2-fluoro-5-(3-phenoxypropoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate (PubChem CID 69142341) has the molecular formula C23H29FN2O4 and a molecular weight of 416.49 g/mol. Its IUPAC name is [2-fluoro-5-(3-phenoxypropoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate.
| Compound Name | [2-fluoro-5-(3-phenoxypropoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 69142341 |
| Molecular Formula | C23H29FN2O4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [2-fluoro-5-(3-phenoxypropoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate |
| SMILES | CC[C@@H]1CNCCN1C(=O)OCc1cc(OCCCOc2ccccc2)ccc1F |
| InChI | InChI=1S/C23H29FN2O4/c1-2-19-16-25-11-12-26(19)23(27)30-17-18-15-21(9-10-22(18)24)29-14-6-13-28-20-7-4-3-5-8-20/h3-5,7-10,15,19,25H,2,6,11-14,16-17H2,1H3/t19-/m1/s1 |
| InChIKey | TXOKXUMVMAKHBE-LJQANCHMSA-N |
| XLogP | 3.99 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|