C24H38N4O3 — CID 69142972
3-amino-4-methoxy-N-[(2R)-3-methyl-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]-1-oxobutan-2-yl]benzamide (PubChem CID 69142972) has the molecular formula C24H38N4O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is 3-amino-4-methoxy-N-[(2R)-3-methyl-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 3-amino-4-methoxy-N-[(2R)-3-methyl-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 69142972 |
| Molecular Formula | C24H38N4O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 3-amino-4-methoxy-N-[(2R)-3-methyl-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H](C(=O)N2CCC(C3CCN(C)CC3)CC2)C(C)C)cc1N |
| InChI | InChI=1S/C24H38N4O3/c1-16(2)22(26-23(29)19-5-6-21(31-4)20(25)15-19)24(30)28-13-9-18(10-14-28)17-7-11-27(3)12-8-17/h5-6,15-18,22H,7-14,25H2,1-4H3,(H,26,29)/t22-/m1/s1 |
| InChIKey | FQQMLPWBOWNFRE-JOCHJYFZSA-N |
| XLogP | 2.61 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|