C40H38N2OS3 — CID 69144814
(4-tert-butylphenyl) N-phenyl-3-phenylsulfanylprop-2-enimidothioate;N-phenyl-3-phenylsulfanylprop-2-enamide (PubChem CID 69144814) has the molecular formula C40H38N2OS3 and a molecular weight of 658.96 g/mol. Its IUPAC name is (4-tert-butylphenyl) N-phenyl-3-phenylsulfanylprop-2-enimidothioate;N-phenyl-3-phenylsulfanylprop-2-enamide.
| Compound Name | (4-tert-butylphenyl) N-phenyl-3-phenylsulfanylprop-2-enimidothioate;N-phenyl-3-phenylsulfanylprop-2-enamide |
|---|---|
| PubChem CID | 69144814 |
| Molecular Formula | C40H38N2OS3 |
| Molecular Weight | 658.96 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | (4-tert-butylphenyl) N-phenyl-3-phenylsulfanylprop-2-enimidothioate;N-phenyl-3-phenylsulfanylprop-2-enamide |
| SMILES | CC(C)(C)c1ccc(S/C(C=CSc2ccccc2)=N/c2ccccc2)cc1.O=C(C=CSc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C25H25NS2.C15H13NOS/c1-25(2,3)20-14-16-23(17-15-20)28-24(26-21-10-6-4-7-11-21)18-19-27-22-12-8-5-9-13-22;17-15(16-13-7-3-1-4-8-13)11-12-18-14-9-5-2-6-10-14/h4-19H,1-3H3;1-12H,(H,16,17)/b19-18?,26-24+; |
| InChIKey | XNGDWQIUEJKNMJ-TWEXYVPRSA-N |
| XLogP | 12.04 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.96 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|