C22H24F3N3O3S2 — CID 69145566
N-[3-[2-[4-(1,3-benzothiazol-2-yloxy)phenyl]ethyl-cyclopropylamino]propyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 69145566) has the molecular formula C22H24F3N3O3S2 and a molecular weight of 499.58 g/mol. Its IUPAC name is N-[3-[2-[4-(1,3-benzothiazol-2-yloxy)phenyl]ethyl-cyclopropylamino]propyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[3-[2-[4-(1,3-benzothiazol-2-yloxy)phenyl]ethyl-cyclopropylamino]propyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 69145566 |
| Molecular Formula | C22H24F3N3O3S2 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | N-[3-[2-[4-(1,3-benzothiazol-2-yloxy)phenyl]ethyl-cyclopropylamino]propyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NCCCN(CCc1ccc(Oc2nc3ccccc3s2)cc1)C1CC1)C(F)(F)F |
| InChI | InChI=1S/C22H24F3N3O3S2/c23-22(24,25)33(29,30)26-13-3-14-28(17-8-9-17)15-12-16-6-10-18(11-7-16)31-21-27-19-4-1-2-5-20(19)32-21/h1-2,4-7,10-11,17,26H,3,8-9,12-15H2 |
| InChIKey | BFJADRMXCONTFJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|