C23H23F3N2O5S2 — CID 87347723
trifluoromethylsulfonyl 4-[2-[4-(1,3-benzothiazol-2-yloxy)phenyl]ethylamino]cyclohexane-1-carboxylate (PubChem CID 87347723) has the molecular formula C23H23F3N2O5S2 and a molecular weight of 528.57 g/mol. Its IUPAC name is trifluoromethylsulfonyl 4-[2-[4-(1,3-benzothiazol-2-yloxy)phenyl]ethylamino]cyclohexane-1-carboxylate.
| Compound Name | trifluoromethylsulfonyl 4-[2-[4-(1,3-benzothiazol-2-yloxy)phenyl]ethylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 87347723 |
| Molecular Formula | C23H23F3N2O5S2 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | trifluoromethylsulfonyl 4-[2-[4-(1,3-benzothiazol-2-yloxy)phenyl]ethylamino]cyclohexane-1-carboxylate |
| SMILES | O=C(OS(=O)(=O)C(F)(F)F)C1CCC(NCCc2ccc(Oc3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C23H23F3N2O5S2/c24-23(25,26)35(30,31)33-21(29)16-7-9-17(10-8-16)27-14-13-15-5-11-18(12-6-15)32-22-28-19-3-1-2-4-20(19)34-22/h1-6,11-12,16-17,27H,7-10,13-14H2 |
| InChIKey | WXDWPKVPQZVZPS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|