C29H27Cl2F2N3O2 — CID 69146772
2-chloro-N-[(1S)-3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4-fluorobenzamide (PubChem CID 69146772) has the molecular formula C29H27Cl2F2N3O2 and a molecular weight of 558.46 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[(1S)-3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 69146772 |
| Molecular Formula | C29H27Cl2F2N3O2 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | 2-chloro-N-[(1S)-3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4-fluorobenzamide |
| SMILES | O=C(N[C@@H](CCN1CC2CN(C(=O)c3c(F)cccc3Cl)CC2C1)c1ccccc1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C29H27Cl2F2N3O2/c30-23-7-4-8-25(33)27(23)29(38)36-16-19-14-35(15-20(19)17-36)12-11-26(18-5-2-1-3-6-18)34-28(37)22-10-9-21(32)13-24(22)31/h1-10,13,19-20,26H,11-12,14-17H2,(H,34,37)/t19?,20?,26-/m0/s1 |
| InChIKey | GPXSRIQEGBFHCE-SALGDXJJSA-N |
| XLogP | 5.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |