C31H34ClFN4O2 — CID 69148230
N-[3-[(3aS)-5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(dimethylamino)benzamide (PubChem CID 69148230) has the molecular formula C31H34ClFN4O2 and a molecular weight of 549.09 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(dimethylamino)benzamide.
| Compound Name | N-[3-[(3aS)-5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 69148230 |
| Molecular Formula | C31H34ClFN4O2 |
| Molecular Weight | 549.09 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | N-[3-[(3aS)-5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccccc1C(=O)NC(CCN1CC2CN(C(=O)c3c(F)cccc3Cl)C[C@@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C31H34ClFN4O2/c1-35(2)28-14-7-6-11-24(28)30(38)34-27(21-9-4-3-5-10-21)15-16-36-17-22-19-37(20-23(22)18-36)31(39)29-25(32)12-8-13-26(29)33/h3-14,22-23,27H,15-20H2,1-2H3,(H,34,38)/t22-,23?,27?/m0/s1 |
| InChIKey | UFFAGPHZUNTCAH-ABOIVYGLSA-N |
| XLogP | 5.11 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.09 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |