C30H41N5O2 — CID 69146974
N-[3-[(3aS)-5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-cyclohexylacetamide (PubChem CID 69146974) has the molecular formula C30H41N5O2 and a molecular weight of 503.69 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-cyclohexylacetamide.
| Compound Name | N-[3-[(3aS)-5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 69146974 |
| Molecular Formula | C30H41N5O2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | N-[3-[(3aS)-5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-cyclohexylacetamide |
| SMILES | Cc1ncnc(C)c1C(=O)N1CC2CN(CCC(NC(=O)CC3CCCCC3)c3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C30H41N5O2/c1-21-29(22(2)32-20-31-21)30(37)35-18-25-16-34(17-26(25)19-35)14-13-27(24-11-7-4-8-12-24)33-28(36)15-23-9-5-3-6-10-23/h4,7-8,11-12,20,23,25-27H,3,5-6,9-10,13-19H2,1-2H3,(H,33,36)/t25-,26?,27?/m0/s1 |
| InChIKey | GNSXDZHJPPQTNR-JRFCFUNGSA-N |
| XLogP | 4.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |