C27H33F2N5O2 — CID 140518518
N-[(1S)-3-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-3,3-difluorocyclobutane-1-carboxamide (PubChem CID 140518518) has the molecular formula C27H33F2N5O2 and a molecular weight of 497.59 g/mol. Its IUPAC name is N-[(1S)-3-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-3,3-difluorocyclobutane-1-carboxamide.
| Compound Name | N-[(1S)-3-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-3,3-difluorocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 140518518 |
| Molecular Formula | C27H33F2N5O2 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | N-[(1S)-3-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-3,3-difluorocyclobutane-1-carboxamide |
| SMILES | Cc1ncnc(C)c1C(=O)N1CC2CN(CC[C@H](NC(=O)C3CC(F)(F)C3)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C27H33F2N5O2/c1-17-24(18(2)31-16-30-17)26(36)34-14-21-12-33(13-22(21)15-34)9-8-23(19-6-4-3-5-7-19)32-25(35)20-10-27(28,29)11-20/h3-7,16,20-23H,8-15H2,1-2H3,(H,32,35)/t21?,22?,23-/m0/s1 |
| InChIKey | NDFHMEJZWSVDOG-VNXZQDSDSA-N |
| XLogP | 3.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |