C30H38F2N4O3 — CID 91089567
N-[3-[(3aS)-5-(2,4-dimethyl-1-oxidopyridin-1-ium-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 91089567) has the molecular formula C30H38F2N4O3 and a molecular weight of 540.66 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(2,4-dimethyl-1-oxidopyridin-1-ium-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[3-[(3aS)-5-(2,4-dimethyl-1-oxidopyridin-1-ium-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91089567 |
| Molecular Formula | C30H38F2N4O3 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | N-[3-[(3aS)-5-(2,4-dimethyl-1-oxidopyridin-1-ium-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | Cc1cc[n+]([O-])c(C)c1C(=O)N1CC2CN(CCC(NC(=O)C3CCC(F)(F)CC3)c3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C30H38F2N4O3/c1-20-10-15-36(39)21(2)27(20)29(38)35-18-24-16-34(17-25(24)19-35)14-11-26(22-6-4-3-5-7-22)33-28(37)23-8-12-30(31,32)13-9-23/h3-7,10,15,23-26H,8-9,11-14,16-19H2,1-2H3,(H,33,37)/t24-,25?,26?/m0/s1 |
| InChIKey | JUMCYGAQXMXYEL-IHSPPPAMSA-N |
| XLogP | 4.01 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|