C31H40F2N4O3 — CID 140518550
4,4-difluoro-N-[(1S)-1-phenyl-3-[5-(1,2,4-trimethyl-6-oxopyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]cyclohexane-1-carboxamide (PubChem CID 140518550) has the molecular formula C31H40F2N4O3 and a molecular weight of 554.68 g/mol. Its IUPAC name is 4,4-difluoro-N-[(1S)-1-phenyl-3-[5-(1,2,4-trimethyl-6-oxopyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]cyclohexane-1-carboxamide.
| Compound Name | 4,4-difluoro-N-[(1S)-1-phenyl-3-[5-(1,2,4-trimethyl-6-oxopyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140518550 |
| Molecular Formula | C31H40F2N4O3 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | 4,4-difluoro-N-[(1S)-1-phenyl-3-[5-(1,2,4-trimethyl-6-oxopyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]cyclohexane-1-carboxamide |
| SMILES | Cc1cc(=O)n(C)c(C)c1C(=O)N1CC2CN(CC[C@H](NC(=O)C3CCC(F)(F)CC3)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C31H40F2N4O3/c1-20-15-27(38)35(3)21(2)28(20)30(40)37-18-24-16-36(17-25(24)19-37)14-11-26(22-7-5-4-6-8-22)34-29(39)23-9-12-31(32,33)13-10-23/h4-8,15,23-26H,9-14,16-19H2,1-3H3,(H,34,39)/t24?,25?,26-/m0/s1 |
| InChIKey | YYCPABLDDOHSQH-WNMGUVTHSA-N |
| XLogP | 4.08 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |