C20H21ClN4S — CID 69148849
3-chloro-2-(2,6-dimethyl-8-pentylimidazo[1,2-b]pyridazin-3-yl)thieno[3,2-b]pyridine (PubChem CID 69148849) has the molecular formula C20H21ClN4S and a molecular weight of 384.94 g/mol. Its IUPAC name is 3-chloro-2-(2,6-dimethyl-8-pentylimidazo[1,2-b]pyridazin-3-yl)thieno[3,2-b]pyridine.
| Compound Name | 3-chloro-2-(2,6-dimethyl-8-pentylimidazo[1,2-b]pyridazin-3-yl)thieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 69148849 |
| Molecular Formula | C20H21ClN4S |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3-chloro-2-(2,6-dimethyl-8-pentylimidazo[1,2-b]pyridazin-3-yl)thieno[3,2-b]pyridine |
| SMILES | CCCCCc1cc(C)nn2c(-c3sc4cccnc4c3Cl)c(C)nc12 |
| InChI | InChI=1S/C20H21ClN4S/c1-4-5-6-8-14-11-12(2)24-25-18(13(3)23-20(14)25)19-16(21)17-15(26-19)9-7-10-22-17/h7,9-11H,4-6,8H2,1-3H3 |
| InChIKey | SYUGLODVTBPBGA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|