C22H18F4N4O — CID 69149809
[4-(2-fluorophenyl)-2-(trifluoromethyl)phenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 69149809) has the molecular formula C22H18F4N4O and a molecular weight of 430.41 g/mol. Its IUPAC name is [4-(2-fluorophenyl)-2-(trifluoromethyl)phenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [4-(2-fluorophenyl)-2-(trifluoromethyl)phenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 69149809 |
| Molecular Formula | C22H18F4N4O |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [4-(2-fluorophenyl)-2-(trifluoromethyl)phenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2F)cc1C(F)(F)F)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H18F4N4O/c23-19-5-2-1-4-16(19)15-6-7-17(18(14-15)22(24,25)26)20(31)29-10-12-30(13-11-29)21-27-8-3-9-28-21/h1-9,14H,10-13H2 |
| InChIKey | WIUJECCMSRXKPL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |