C18H23NO6 — CID 69150420
1-[1-amino-2-(1-benzoyloxyethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid (PubChem CID 69150420) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 1-[1-amino-2-(1-benzoyloxyethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[1-amino-2-(1-benzoyloxyethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 69150420 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-[1-amino-2-(1-benzoyloxyethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(OC(=O)c1ccccc1)OC(=O)C(N)C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C18H23NO6/c1-12(24-15(20)13-8-4-2-5-9-13)25-16(21)14(19)18(17(22)23)10-6-3-7-11-18/h2,4-5,8-9,12,14H,3,6-7,10-11,19H2,1H3,(H,22,23) |
| InChIKey | FTKMNWBHHJWTMT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|