C23H26FNO4 — CID 69153756
2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-3-yl]methoxy]benzoic acid (PubChem CID 69153756) has the molecular formula C23H26FNO4 and a molecular weight of 399.46 g/mol. Its IUPAC name is 2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-3-yl]methoxy]benzoic acid.
| Compound Name | 2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-3-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 69153756 |
| Molecular Formula | C23H26FNO4 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-3-yl]methoxy]benzoic acid |
| SMILES | O=C(CCCN1CCCC(COc2ccccc2C(=O)O)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FNO4/c24-19-11-9-18(10-12-19)21(26)7-4-14-25-13-3-5-17(15-25)16-29-22-8-2-1-6-20(22)23(27)28/h1-2,6,8-12,17H,3-5,7,13-16H2,(H,27,28) |
| InChIKey | YJFFAYUSXGUYSS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |