C22H26FNO4S — CID 87613951
2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-3-yl]methyl]benzenesulfonic acid (PubChem CID 87613951) has the molecular formula C22H26FNO4S and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-3-yl]methyl]benzenesulfonic acid.
| Compound Name | 2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-3-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87613951 |
| Molecular Formula | C22H26FNO4S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-3-yl]methyl]benzenesulfonic acid |
| SMILES | O=C(CCCN1CCCC(Cc2ccccc2S(=O)(=O)O)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H26FNO4S/c23-20-11-9-18(10-12-20)21(25)7-4-14-24-13-3-5-17(16-24)15-19-6-1-2-8-22(19)29(26,27)28/h1-2,6,8-12,17H,3-5,7,13-16H2,(H,26,27,28) |
| InChIKey | UFULWFHCFZHCOY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|