C30H35FN2O3 — CID 19772029
1-[4-[3-[3-[[2-(4-fluoroanilino)phenyl]methyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone (PubChem CID 19772029) has the molecular formula C30H35FN2O3 and a molecular weight of 490.62 g/mol. Its IUPAC name is 1-[4-[3-[3-[[2-(4-fluoroanilino)phenyl]methyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone.
| Compound Name | 1-[4-[3-[3-[[2-(4-fluoroanilino)phenyl]methyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 19772029 |
| Molecular Formula | C30H35FN2O3 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 1-[4-[3-[3-[[2-(4-fluoroanilino)phenyl]methyl]piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCCCN1CCCC(Cc2ccccc2Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C30H35FN2O3/c1-22(34)24-10-15-29(30(20-24)35-2)36-18-6-17-33-16-5-7-23(21-33)19-25-8-3-4-9-28(25)32-27-13-11-26(31)12-14-27/h3-4,8-15,20,23,32H,5-7,16-19,21H2,1-2H3 |
| InChIKey | PXJZNWJHFJHJAU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|