C24H23N3O3S2 — CID 69154922
2-[4-[benzenesulfonyl(piperazin-1-yl)methyl]phenoxy]-1,3-benzothiazole (PubChem CID 69154922) has the molecular formula C24H23N3O3S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 2-[4-[benzenesulfonyl(piperazin-1-yl)methyl]phenoxy]-1,3-benzothiazole.
| Compound Name | 2-[4-[benzenesulfonyl(piperazin-1-yl)methyl]phenoxy]-1,3-benzothiazole |
|---|---|
| PubChem CID | 69154922 |
| Molecular Formula | C24H23N3O3S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-[4-[benzenesulfonyl(piperazin-1-yl)methyl]phenoxy]-1,3-benzothiazole |
| SMILES | O=S(=O)(c1ccccc1)C(c1ccc(Oc2nc3ccccc3s2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C24H23N3O3S2/c28-32(29,20-6-2-1-3-7-20)23(27-16-14-25-15-17-27)18-10-12-19(13-11-18)30-24-26-21-8-4-5-9-22(21)31-24/h1-13,23,25H,14-17H2 |
| InChIKey | KPRMVTCFZJFODE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |