C30H37N5O4 — CID 69157049
[2-[6-benzamido-1-(3-methylbut-2-enyl)benzimidazol-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl] tert-butyl carbonate (PubChem CID 69157049) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is [2-[6-benzamido-1-(3-methylbut-2-enyl)benzimidazol-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl] tert-butyl carbonate.
| Compound Name | [2-[6-benzamido-1-(3-methylbut-2-enyl)benzimidazol-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 69157049 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | [2-[6-benzamido-1-(3-methylbut-2-enyl)benzimidazol-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl] tert-butyl carbonate |
| SMILES | CC(C)=CCn1c(N2CC3CN(OC(=O)OC(C)(C)C)CC3C2)nc2ccc(NC(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C30H37N5O4/c1-20(2)13-14-35-26-15-24(31-27(36)21-9-7-6-8-10-21)11-12-25(26)32-28(35)33-16-22-18-34(19-23(22)17-33)39-29(37)38-30(3,4)5/h6-13,15,22-23H,14,16-19H2,1-5H3,(H,31,36) |
| InChIKey | BDWUKPGXTKBILD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|