C44H24Cl2N8S2 — CID 69157302
2,3-bis[3-chloro-4-(8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile (PubChem CID 69157302) has the molecular formula C44H24Cl2N8S2 and a molecular weight of 799.77 g/mol. Its IUPAC name is 2,3-bis[3-chloro-4-(8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile.
| Compound Name | 2,3-bis[3-chloro-4-(8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile |
|---|---|
| PubChem CID | 69157302 |
| Molecular Formula | C44H24Cl2N8S2 |
| Molecular Weight | 799.77 g/mol |
| Exact Mass | 798.09 |
| IUPAC Name | 2,3-bis[3-chloro-4-(8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile |
| SMILES | N#CC(c1ccc(-n2cnc3cnc4ccc(-c5cccs5)cc4c32)c(Cl)c1)C(C#N)c1ccc(-n2cnc3cnc4ccc(-c5cccs5)cc4c32)c(Cl)c1 |
| InChI | InChI=1S/C44H24Cl2N8S2/c45-33-17-25(7-11-39(33)53-23-51-37-21-49-35-9-5-27(15-29(35)43(37)53)41-3-1-13-55-41)31(19-47)32(20-48)26-8-12-40(34(46)18-26)54-24-52-38-22-50-36-10-6-28(16-30(36)44(38)54)42-4-2-14-56-42/h1-18,21-24,31-32H |
| InChIKey | CJSCVUZWRUMKLX-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 109.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.77 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |