C28H34N6O4 — CID 69159690
tert-butyl [4-[[methyl-[6-[2-(pyridine-2-carbonyl)anilino]pyrimidin-4-yl]amino]methyl]piperidin-1-yl] carbonate (PubChem CID 69159690) has the molecular formula C28H34N6O4 and a molecular weight of 518.62 g/mol. Its IUPAC name is tert-butyl [4-[[methyl-[6-[2-(pyridine-2-carbonyl)anilino]pyrimidin-4-yl]amino]methyl]piperidin-1-yl] carbonate.
| Compound Name | tert-butyl [4-[[methyl-[6-[2-(pyridine-2-carbonyl)anilino]pyrimidin-4-yl]amino]methyl]piperidin-1-yl] carbonate |
|---|---|
| PubChem CID | 69159690 |
| Molecular Formula | C28H34N6O4 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | tert-butyl [4-[[methyl-[6-[2-(pyridine-2-carbonyl)anilino]pyrimidin-4-yl]amino]methyl]piperidin-1-yl] carbonate |
| SMILES | CN(CC1CCN(OC(=O)OC(C)(C)C)CC1)c1cc(Nc2ccccc2C(=O)c2ccccn2)ncn1 |
| InChI | InChI=1S/C28H34N6O4/c1-28(2,3)37-27(36)38-34-15-12-20(13-16-34)18-33(4)25-17-24(30-19-31-25)32-22-10-6-5-9-21(22)26(35)23-11-7-8-14-29-23/h5-11,14,17,19-20H,12-13,15-16,18H2,1-4H3,(H,30,31,32) |
| InChIKey | AMBHDMXYKNLWJM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|