C23H32FN7O3 — CID 69161935
[4-[[[6-(4-carbamimidoyl-2-fluoroanilino)pyrimidin-4-yl]-methylamino]methyl]piperidin-1-yl] 2-methylpropyl carbonate (PubChem CID 69161935) has the molecular formula C23H32FN7O3 and a molecular weight of 473.55 g/mol. Its IUPAC name is [4-[[[6-(4-carbamimidoyl-2-fluoroanilino)pyrimidin-4-yl]-methylamino]methyl]piperidin-1-yl] 2-methylpropyl carbonate.
| Compound Name | [4-[[[6-(4-carbamimidoyl-2-fluoroanilino)pyrimidin-4-yl]-methylamino]methyl]piperidin-1-yl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 69161935 |
| Molecular Formula | C23H32FN7O3 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | [4-[[[6-(4-carbamimidoyl-2-fluoroanilino)pyrimidin-4-yl]-methylamino]methyl]piperidin-1-yl] 2-methylpropyl carbonate |
| SMILES | [H]/N=C(\N)c1ccc(Nc2cc(N(C)CC3CCN(OC(=O)OCC(C)C)CC3)ncn2)c(F)c1 |
| InChI | InChI=1S/C23H32FN7O3/c1-15(2)13-33-23(32)34-31-8-6-16(7-9-31)12-30(3)21-11-20(27-14-28-21)29-19-5-4-17(22(25)26)10-18(19)24/h4-5,10-11,14-16H,6-9,12-13H2,1-3H3,(H3,25,26)(H,27,28,29) |
| InChIKey | WCRHXSOWVOGYIO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 129.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|