C24H22FNO3 — CID 69159890
(2S,3S)-3-(3-fluorophenyl)-3-(5-phenylmethoxyindol-1-yl)propane-1,2-diol (PubChem CID 69159890) has the molecular formula C24H22FNO3 and a molecular weight of 391.44 g/mol. Its IUPAC name is (2S,3S)-3-(3-fluorophenyl)-3-(5-phenylmethoxyindol-1-yl)propane-1,2-diol.
| Compound Name | (2S,3S)-3-(3-fluorophenyl)-3-(5-phenylmethoxyindol-1-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 69159890 |
| Molecular Formula | C24H22FNO3 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (2S,3S)-3-(3-fluorophenyl)-3-(5-phenylmethoxyindol-1-yl)propane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H](c1cccc(F)c1)n1ccc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C24H22FNO3/c25-20-8-4-7-19(13-20)24(23(28)15-27)26-12-11-18-14-21(9-10-22(18)26)29-16-17-5-2-1-3-6-17/h1-14,23-24,27-28H,15-16H2/t23-,24+/m1/s1 |
| InChIKey | YPYVZHONDSDHSJ-RPWUZVMVSA-N |
| XLogP | 4.30 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |