C18H15FN2O2 — CID 68907607
1-[1-(3-fluorophenyl)-2,3-dihydroxypropyl]indole-4-carbonitrile (PubChem CID 68907607) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)-2,3-dihydroxypropyl]indole-4-carbonitrile.
| Compound Name | 1-[1-(3-fluorophenyl)-2,3-dihydroxypropyl]indole-4-carbonitrile |
|---|---|
| PubChem CID | 68907607 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-[1-(3-fluorophenyl)-2,3-dihydroxypropyl]indole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1ccn2C(c1cccc(F)c1)C(O)CO |
| InChI | InChI=1S/C18H15FN2O2/c19-14-5-1-3-12(9-14)18(17(23)11-22)21-8-7-15-13(10-20)4-2-6-16(15)21/h1-9,17-18,22-23H,11H2 |
| InChIKey | VLDBXZIRKPIVJT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |